C10H8F2N2O2 — CID 175332870
1-(3-cyano-2,5-difluorophenyl)ethyl carbamate (PubChem CID 175332870) has the molecular formula C10H8F2N2O2 and a molecular weight of 226.18 g/mol. Its IUPAC name is 1-(3-cyano-2,5-difluorophenyl)ethyl carbamate.
| Compound Name | 1-(3-cyano-2,5-difluorophenyl)ethyl carbamate |
|---|---|
| PubChem CID | 175332870 |
| Molecular Formula | C10H8F2N2O2 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 1-(3-cyano-2,5-difluorophenyl)ethyl carbamate |
| SMILES | CC(OC(N)=O)c1cc(F)cc(C#N)c1F |
| InChI | InChI=1S/C10H8F2N2O2/c1-5(16-10(14)15)8-3-7(11)2-6(4-13)9(8)12/h2-3,5H,1H3,(H2,14,15) |
| InChIKey | VQCALDCTBDWQFU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |