C8H9N3S — CID 134459844
4,5-diamino-2-methylsulfanylbenzonitrile (PubChem CID 134459844) has the molecular formula C8H9N3S and a molecular weight of 179.25 g/mol. Its IUPAC name is 4,5-diamino-2-methylsulfanylbenzonitrile.
| Compound Name | 4,5-diamino-2-methylsulfanylbenzonitrile |
|---|---|
| PubChem CID | 134459844 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 4,5-diamino-2-methylsulfanylbenzonitrile |
| SMILES | CSc1cc(N)c(N)cc1C#N |
| InChI | InChI=1S/C8H9N3S/c1-12-8-3-7(11)6(10)2-5(8)4-9/h2-3H,10-11H2,1H3 |
| InChIKey | AKMOQAYAIWHKCH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|