C10H11NO2S — CID 117298733
2,5-dimethoxy-4-methylsulfanylbenzonitrile (PubChem CID 117298733) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 2,5-dimethoxy-4-methylsulfanylbenzonitrile.
| Compound Name | 2,5-dimethoxy-4-methylsulfanylbenzonitrile |
|---|---|
| PubChem CID | 117298733 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2,5-dimethoxy-4-methylsulfanylbenzonitrile |
| SMILES | COc1cc(SC)c(OC)cc1C#N |
| InChI | InChI=1S/C10H11NO2S/c1-12-8-5-10(14-3)9(13-2)4-7(8)6-11/h4-5H,1-3H3 |
| InChIKey | LHJJFBGSJZNJDQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |