C11H12FNO2 — CID 117298364
5-(1-fluoroethyl)-2,4-dimethoxybenzonitrile (PubChem CID 117298364) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is 5-(1-fluoroethyl)-2,4-dimethoxybenzonitrile.
| Compound Name | 5-(1-fluoroethyl)-2,4-dimethoxybenzonitrile |
|---|---|
| PubChem CID | 117298364 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 5-(1-fluoroethyl)-2,4-dimethoxybenzonitrile |
| SMILES | COc1cc(OC)c(C(C)F)cc1C#N |
| InChI | InChI=1S/C11H12FNO2/c1-7(12)9-4-8(6-13)10(14-2)5-11(9)15-3/h4-5,7H,1-3H3 |
| InChIKey | ZIVDNAKUPLRNDH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |