C12H18FNO2 — CID 117327151
2-[5-(1-fluoroethyl)-2,4-dimethoxyphenyl]ethanamine (PubChem CID 117327151) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is 2-[5-(1-fluoroethyl)-2,4-dimethoxyphenyl]ethanamine.
| Compound Name | 2-[5-(1-fluoroethyl)-2,4-dimethoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 117327151 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-[5-(1-fluoroethyl)-2,4-dimethoxyphenyl]ethanamine |
| SMILES | COc1cc(OC)c(C(C)F)cc1CCN |
| InChI | InChI=1S/C12H18FNO2/c1-8(13)10-6-9(4-5-14)11(15-2)7-12(10)16-3/h6-8H,4-5,14H2,1-3H3 |
| InChIKey | OVUNGHBRTHWDQE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |