C12H16F3NO2 — CID 57498513
2-[2,5-dimethoxy-4-(2,2,2-trifluoroethyl)phenyl]ethanamine (PubChem CID 57498513) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-[2,5-dimethoxy-4-(2,2,2-trifluoroethyl)phenyl]ethanamine.
| Compound Name | 2-[2,5-dimethoxy-4-(2,2,2-trifluoroethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 57498513 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-[2,5-dimethoxy-4-(2,2,2-trifluoroethyl)phenyl]ethanamine |
| SMILES | COc1cc(CC(F)(F)F)c(OC)cc1CCN |
| InChI | InChI=1S/C12H16F3NO2/c1-17-10-6-9(7-12(13,14)15)11(18-2)5-8(10)3-4-16/h5-6H,3-4,7,16H2,1-2H3 |
| InChIKey | DVENUPQPPXYSLN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |