C14H17F2NO2 — CID 169149409
2-[4-(1,1-difluorobut-3-ynyl)-2,5-dimethoxyphenyl]ethanamine (PubChem CID 169149409) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is 2-[4-(1,1-difluorobut-3-ynyl)-2,5-dimethoxyphenyl]ethanamine.
| Compound Name | 2-[4-(1,1-difluorobut-3-ynyl)-2,5-dimethoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 169149409 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-[4-(1,1-difluorobut-3-ynyl)-2,5-dimethoxyphenyl]ethanamine |
| SMILES | C#CCC(F)(F)c1cc(OC)c(CCN)cc1OC |
| InChI | InChI=1S/C14H17F2NO2/c1-4-6-14(15,16)11-9-12(18-2)10(5-7-17)8-13(11)19-3/h1,8-9H,5-7,17H2,2-3H3 |
| InChIKey | BEHRSHAOUZHICQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|