C11H14F3NO2 — CID 169149369
2-[2,5-bis(trideuteriomethoxy)-4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 169149369) has the molecular formula C11H14F3NO2 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-[2,5-bis(trideuteriomethoxy)-4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-[2,5-bis(trideuteriomethoxy)-4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 169149369 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-[2,5-bis(trideuteriomethoxy)-4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | [2H]C([2H])([2H])Oc1cc(C(F)(F)F)c(OC([2H])([2H])[2H])cc1CCN |
| InChI | InChI=1S/C11H14F3NO2/c1-16-9-6-8(11(12,13)14)10(17-2)5-7(9)3-4-15/h5-6H,3-4,15H2,1-2H3/i1D3,2D3 |
| InChIKey | LYXGNMLWYONZID-WFGJKAKNSA-N |
| XLogP | 2.22 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |