About CID 162430150
CID 162430150 (PubChem CID 162430150) has the molecular formula C11H13BF3NO3
and a molecular weight of 275.03 g/mol.
Molecular Properties
| Compound Name | CID 162430150 |
| PubChem CID | 162430150 |
| Molecular Formula | C11H13BF3NO3 |
| Molecular Weight | 275.03 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | — |
| SMILES | [B]C(O)(CN)c1cc(OC)c(C(F)(F)F)cc1OC |
| InChI | InChI=1S/C11H13BF3NO3/c1-18-8-4-7(11(13,14)15)9(19-2)3-6(8)10(12,17)5-16/h3-4,17H,5,16H2,1-2H3 |
| InChIKey | SRTVIOXKHYWIJE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.03 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162430150 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162430150?
The IUPAC name of CID 162430150 (CID 162430150) is not available.
What is the SMILES notation for CID 162430150?
The canonical SMILES for CID 162430150 is [B]C(O)(CN)c1cc(OC)c(C(F)(F)F)cc1OC.
What is the InChIKey of CID 162430150?
The InChIKey is SRTVIOXKHYWIJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BF3NO3/c1-18-8-4-7(11(13,14)15)9(19-2)3-6(8)10(12,17)5-16/h3-4,17H,5,16H2,1-2H3.
What are the key properties of CID 162430150?
CID 162430150 has a molecular weight of 275.03 g/mol, XLogP of 0.99, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162430150 is sourced from PubChem (CID 162430150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).