C9H8BrF3O2 — CID 131371239
1-bromo-2,4-dimethoxy-5-(trifluoromethyl)benzene (PubChem CID 131371239) has the molecular formula C9H8BrF3O2 and a molecular weight of 285.06 g/mol. Its IUPAC name is 1-bromo-2,4-dimethoxy-5-(trifluoromethyl)benzene.
| Compound Name | 1-bromo-2,4-dimethoxy-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 131371239 |
| Molecular Formula | C9H8BrF3O2 |
| Molecular Weight | 285.06 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 1-bromo-2,4-dimethoxy-5-(trifluoromethyl)benzene |
| SMILES | COc1cc(OC)c(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C9H8BrF3O2/c1-14-7-4-8(15-2)6(10)3-5(7)9(11,12)13/h3-4H,1-2H3 |
| InChIKey | QCNSZZGCDRABNL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.06 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |