C18H16Br2O4 — CID 172870430
1-bromo-5-[2-(5-bromo-2,4-dimethoxyphenyl)ethynyl]-2,4-dimethoxybenzene (PubChem CID 172870430) has the molecular formula C18H16Br2O4 and a molecular weight of 456.13 g/mol. Its IUPAC name is 1-bromo-5-[2-(5-bromo-2,4-dimethoxyphenyl)ethynyl]-2,4-dimethoxybenzene.
| Compound Name | 1-bromo-5-[2-(5-bromo-2,4-dimethoxyphenyl)ethynyl]-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 172870430 |
| Molecular Formula | C18H16Br2O4 |
| Molecular Weight | 456.13 g/mol |
| Exact Mass | 453.94 |
| IUPAC Name | 1-bromo-5-[2-(5-bromo-2,4-dimethoxyphenyl)ethynyl]-2,4-dimethoxybenzene |
| SMILES | COc1cc(OC)c(C#Cc2cc(Br)c(OC)cc2OC)cc1Br |
| InChI | InChI=1S/C18H16Br2O4/c1-21-15-9-17(23-3)13(19)7-11(15)5-6-12-8-14(20)18(24-4)10-16(12)22-2/h7-10H,1-4H3 |
| InChIKey | ROCKNDLPANSNQQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.13 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|