C8H9BrO2S — CID 50989231
5-bromo-2,4-dimethoxybenzenethiol (PubChem CID 50989231) has the molecular formula C8H9BrO2S and a molecular weight of 249.13 g/mol. Its IUPAC name is 5-bromo-2,4-dimethoxybenzenethiol.
| Compound Name | 5-bromo-2,4-dimethoxybenzenethiol |
|---|---|
| PubChem CID | 50989231 |
| Molecular Formula | C8H9BrO2S |
| Molecular Weight | 249.13 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | 5-bromo-2,4-dimethoxybenzenethiol |
| SMILES | COc1cc(OC)c(Br)cc1S |
| InChI | InChI=1S/C8H9BrO2S/c1-10-6-4-7(11-2)8(12)3-5(6)9/h3-4,12H,1-2H3 |
| InChIKey | GQJFGNBPPVKCHN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.13 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|