C16H16Br2O2Si — CID 11524744
3,7-dibromo-2,8-dimethoxy-5,5-dimethylbenzo[b][1]benzosilole (PubChem CID 11524744) has the molecular formula C16H16Br2O2Si and a molecular weight of 428.20 g/mol. Its IUPAC name is 3,7-dibromo-2,8-dimethoxy-5,5-dimethylbenzo[b][1]benzosilole.
| Compound Name | 3,7-dibromo-2,8-dimethoxy-5,5-dimethylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 11524744 |
| Molecular Formula | C16H16Br2O2Si |
| Molecular Weight | 428.20 g/mol |
| Exact Mass | 425.93 |
| IUPAC Name | 3,7-dibromo-2,8-dimethoxy-5,5-dimethylbenzo[b][1]benzosilole |
| SMILES | COc1cc2c(cc1Br)[Si](C)(C)c1cc(Br)c(OC)cc1-2 |
| InChI | InChI=1S/C16H16Br2O2Si/c1-19-13-5-9-10-6-14(20-2)12(18)8-16(10)21(3,4)15(9)7-11(13)17/h5-8H,1-4H3 |
| InChIKey | RQWJEDZKGQSIED-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.20 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|