C30H44Br2O2Si — CID 122227107
3,7-dibromo-2,8-dimethoxy-5,5-dioctylbenzo[b][1]benzosilole (PubChem CID 122227107) has the molecular formula C30H44Br2O2Si and a molecular weight of 624.57 g/mol. Its IUPAC name is 3,7-dibromo-2,8-dimethoxy-5,5-dioctylbenzo[b][1]benzosilole.
| Compound Name | 3,7-dibromo-2,8-dimethoxy-5,5-dioctylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 122227107 |
| Molecular Formula | C30H44Br2O2Si |
| Molecular Weight | 624.57 g/mol |
| Exact Mass | 622.15 |
| IUPAC Name | 3,7-dibromo-2,8-dimethoxy-5,5-dioctylbenzo[b][1]benzosilole |
| SMILES | CCCCCCCC[Si]1(CCCCCCCC)c2cc(Br)c(OC)cc2-c2cc(OC)c(Br)cc21 |
| InChI | InChI=1S/C30H44Br2O2Si/c1-5-7-9-11-13-15-17-35(18-16-14-12-10-8-6-2)29-21-25(31)27(33-3)19-23(29)24-20-28(34-4)26(32)22-30(24)35/h19-22H,5-18H2,1-4H3 |
| InChIKey | YMNOIGGPXAFBEO-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.57 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|