C14H20BrClO2 — CID 105057265
1-bromo-4-(1-chlorohexyl)-2,5-dimethoxybenzene (PubChem CID 105057265) has the molecular formula C14H20BrClO2 and a molecular weight of 335.67 g/mol. Its IUPAC name is 1-bromo-4-(1-chlorohexyl)-2,5-dimethoxybenzene.
| Compound Name | 1-bromo-4-(1-chlorohexyl)-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 105057265 |
| Molecular Formula | C14H20BrClO2 |
| Molecular Weight | 335.67 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 1-bromo-4-(1-chlorohexyl)-2,5-dimethoxybenzene |
| SMILES | CCCCCC(Cl)c1cc(OC)c(Br)cc1OC |
| InChI | InChI=1S/C14H20BrClO2/c1-4-5-6-7-12(16)10-8-14(18-3)11(15)9-13(10)17-2/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | AWJKJCAOWTUDCR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|