C15H22BrClO2 — CID 114246943
1-bromo-4-(1-chloro-2-methylhexyl)-2,5-dimethoxybenzene (PubChem CID 114246943) has the molecular formula C15H22BrClO2 and a molecular weight of 349.70 g/mol. Its IUPAC name is 1-bromo-4-(1-chloro-2-methylhexyl)-2,5-dimethoxybenzene.
| Compound Name | 1-bromo-4-(1-chloro-2-methylhexyl)-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 114246943 |
| Molecular Formula | C15H22BrClO2 |
| Molecular Weight | 349.70 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 1-bromo-4-(1-chloro-2-methylhexyl)-2,5-dimethoxybenzene |
| SMILES | CCCCC(C)C(Cl)c1cc(OC)c(Br)cc1OC |
| InChI | InChI=1S/C15H22BrClO2/c1-5-6-7-10(2)15(17)11-8-14(19-4)12(16)9-13(11)18-3/h8-10,15H,5-7H2,1-4H3 |
| InChIKey | MEIOJMBQBLFFCR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.70 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|