C17H28BrNO2 — CID 105056755
1-(4-bromo-2,5-dimethoxyphenyl)-N-methyl-2-propylpentan-1-amine (PubChem CID 105056755) has the molecular formula C17H28BrNO2 and a molecular weight of 358.32 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dimethoxyphenyl)-N-methyl-2-propylpentan-1-amine.
| Compound Name | 1-(4-bromo-2,5-dimethoxyphenyl)-N-methyl-2-propylpentan-1-amine |
|---|---|
| PubChem CID | 105056755 |
| Molecular Formula | C17H28BrNO2 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-(4-bromo-2,5-dimethoxyphenyl)-N-methyl-2-propylpentan-1-amine |
| SMILES | CCCC(CCC)C(NC)c1cc(OC)c(Br)cc1OC |
| InChI | InChI=1S/C17H28BrNO2/c1-6-8-12(9-7-2)17(19-3)13-10-16(21-5)14(18)11-15(13)20-4/h10-12,17,19H,6-9H2,1-5H3 |
| InChIKey | JTQCHLBWDFBRBS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |