C17H28BrNO2 — CID 105056855
1-(4-bromo-2,5-dimethoxyphenyl)-N-propylhexan-1-amine (PubChem CID 105056855) has the molecular formula C17H28BrNO2 and a molecular weight of 358.32 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dimethoxyphenyl)-N-propylhexan-1-amine.
| Compound Name | 1-(4-bromo-2,5-dimethoxyphenyl)-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 105056855 |
| Molecular Formula | C17H28BrNO2 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-(4-bromo-2,5-dimethoxyphenyl)-N-propylhexan-1-amine |
| SMILES | CCCCCC(NCCC)c1cc(OC)c(Br)cc1OC |
| InChI | InChI=1S/C17H28BrNO2/c1-5-7-8-9-15(19-10-6-2)13-11-17(21-4)14(18)12-16(13)20-3/h11-12,15,19H,5-10H2,1-4H3 |
| InChIKey | MYBHCQLPVSLWGE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|