C15H24BrNO2 — CID 105056702
1-(4-bromo-2,5-dimethoxyphenyl)-N,3-dimethylpentan-1-amine (PubChem CID 105056702) has the molecular formula C15H24BrNO2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dimethoxyphenyl)-N,3-dimethylpentan-1-amine.
| Compound Name | 1-(4-bromo-2,5-dimethoxyphenyl)-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 105056702 |
| Molecular Formula | C15H24BrNO2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-(4-bromo-2,5-dimethoxyphenyl)-N,3-dimethylpentan-1-amine |
| SMILES | CCC(C)CC(NC)c1cc(OC)c(Br)cc1OC |
| InChI | InChI=1S/C15H24BrNO2/c1-6-10(2)7-13(17-3)11-8-15(19-5)12(16)9-14(11)18-4/h8-10,13,17H,6-7H2,1-5H3 |
| InChIKey | MCXOWBKXTGWMOG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |