C11H17BrN2O2 — CID 62065826
1-(2-bromo-4,5-dimethoxyphenyl)-N-methylethane-1,2-diamine (PubChem CID 62065826) has the molecular formula C11H17BrN2O2 and a molecular weight of 289.17 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)-N-methylethane-1,2-diamine.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 62065826 |
| Molecular Formula | C11H17BrN2O2 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)-N-methylethane-1,2-diamine |
| SMILES | CNC(CN)c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C11H17BrN2O2/c1-14-9(6-13)7-4-10(15-2)11(16-3)5-8(7)12/h4-5,9,14H,6,13H2,1-3H3 |
| InChIKey | OPWVTNZFOAVCCV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |