C12H21NOS — CID 115846200
1-(3-methoxythiophen-2-yl)-N,3-dimethylpentan-1-amine (PubChem CID 115846200) has the molecular formula C12H21NOS and a molecular weight of 227.37 g/mol. Its IUPAC name is 1-(3-methoxythiophen-2-yl)-N,3-dimethylpentan-1-amine.
| Compound Name | 1-(3-methoxythiophen-2-yl)-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 115846200 |
| Molecular Formula | C12H21NOS |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-(3-methoxythiophen-2-yl)-N,3-dimethylpentan-1-amine |
| SMILES | CCC(C)CC(NC)c1sccc1OC |
| InChI | InChI=1S/C12H21NOS/c1-5-9(2)8-10(13-3)12-11(14-4)6-7-15-12/h6-7,9-10,13H,5,8H2,1-4H3 |
| InChIKey | UQQCZLMVFQISJR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |