C13H19Br2NO2 — CID 83046199
2-(2,5-dibromo-4-methoxyphenoxy)-N-methylpentan-1-amine (PubChem CID 83046199) has the molecular formula C13H19Br2NO2 and a molecular weight of 381.11 g/mol. Its IUPAC name is 2-(2,5-dibromo-4-methoxyphenoxy)-N-methylpentan-1-amine.
| Compound Name | 2-(2,5-dibromo-4-methoxyphenoxy)-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 83046199 |
| Molecular Formula | C13H19Br2NO2 |
| Molecular Weight | 381.11 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | 2-(2,5-dibromo-4-methoxyphenoxy)-N-methylpentan-1-amine |
| SMILES | CCCC(CNC)Oc1cc(Br)c(OC)cc1Br |
| InChI | InChI=1S/C13H19Br2NO2/c1-4-5-9(8-16-2)18-13-7-10(14)12(17-3)6-11(13)15/h6-7,9,16H,4-5,8H2,1-3H3 |
| InChIKey | PLFSUTIJSBQMQV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.11 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |