C14H21Br2NO2 — CID 79404261
2-(2,5-dibromo-4-methoxyphenoxy)-N-propylbutan-1-amine (PubChem CID 79404261) has the molecular formula C14H21Br2NO2 and a molecular weight of 395.14 g/mol. Its IUPAC name is 2-(2,5-dibromo-4-methoxyphenoxy)-N-propylbutan-1-amine.
| Compound Name | 2-(2,5-dibromo-4-methoxyphenoxy)-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 79404261 |
| Molecular Formula | C14H21Br2NO2 |
| Molecular Weight | 395.14 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 2-(2,5-dibromo-4-methoxyphenoxy)-N-propylbutan-1-amine |
| SMILES | CCCNCC(CC)Oc1cc(Br)c(OC)cc1Br |
| InChI | InChI=1S/C14H21Br2NO2/c1-4-6-17-9-10(5-2)19-14-8-11(15)13(18-3)7-12(14)16/h7-8,10,17H,4-6,9H2,1-3H3 |
| InChIKey | AKEITGGFRWARDS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.14 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|