C13H18BrCl2NO2 — CID 107661120
2-(4-bromo-2,5-dichlorophenoxy)-3-methoxy-N-propylpropan-1-amine (PubChem CID 107661120) has the molecular formula C13H18BrCl2NO2 and a molecular weight of 371.10 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dichlorophenoxy)-3-methoxy-N-propylpropan-1-amine.
| Compound Name | 2-(4-bromo-2,5-dichlorophenoxy)-3-methoxy-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 107661120 |
| Molecular Formula | C13H18BrCl2NO2 |
| Molecular Weight | 371.10 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 2-(4-bromo-2,5-dichlorophenoxy)-3-methoxy-N-propylpropan-1-amine |
| SMILES | CCCNCC(COC)Oc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C13H18BrCl2NO2/c1-3-4-17-7-9(8-18-2)19-13-6-11(15)10(14)5-12(13)16/h5-6,9,17H,3-4,7-8H2,1-2H3 |
| InChIKey | UONJFMXODYBRBX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.10 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|