C15H22Cl3NO — CID 83046652
N-(2-methylpropyl)-2-(2,4,5-trichlorophenoxy)pentan-1-amine (PubChem CID 83046652) has the molecular formula C15H22Cl3NO and a molecular weight of 338.71 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-(2,4,5-trichlorophenoxy)pentan-1-amine.
| Compound Name | N-(2-methylpropyl)-2-(2,4,5-trichlorophenoxy)pentan-1-amine |
|---|---|
| PubChem CID | 83046652 |
| Molecular Formula | C15H22Cl3NO |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N-(2-methylpropyl)-2-(2,4,5-trichlorophenoxy)pentan-1-amine |
| SMILES | CCCC(CNCC(C)C)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H22Cl3NO/c1-4-5-11(9-19-8-10(2)3)20-15-7-13(17)12(16)6-14(15)18/h6-7,10-11,19H,4-5,8-9H2,1-3H3 |
| InChIKey | CSOBCMZKBXNZAK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|