C13H18Cl3NO2 — CID 103228070
3-methoxy-N-propan-2-yl-2-(2,4,5-trichlorophenoxy)propan-1-amine (PubChem CID 103228070) has the molecular formula C13H18Cl3NO2 and a molecular weight of 326.65 g/mol. Its IUPAC name is 3-methoxy-N-propan-2-yl-2-(2,4,5-trichlorophenoxy)propan-1-amine.
| Compound Name | 3-methoxy-N-propan-2-yl-2-(2,4,5-trichlorophenoxy)propan-1-amine |
|---|---|
| PubChem CID | 103228070 |
| Molecular Formula | C13H18Cl3NO2 |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 3-methoxy-N-propan-2-yl-2-(2,4,5-trichlorophenoxy)propan-1-amine |
| SMILES | COCC(CNC(C)C)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl3NO2/c1-8(2)17-6-9(7-18-3)19-13-5-11(15)10(14)4-12(13)16/h4-5,8-9,17H,6-7H2,1-3H3 |
| InChIKey | BVPXQLSLUOEIMA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|