C13H19ClFNO2 — CID 103228708
2-(3-chloro-4-fluorophenoxy)-3-methoxy-N-propan-2-ylpropan-1-amine (PubChem CID 103228708) has the molecular formula C13H19ClFNO2 and a molecular weight of 275.75 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenoxy)-3-methoxy-N-propan-2-ylpropan-1-amine.
| Compound Name | 2-(3-chloro-4-fluorophenoxy)-3-methoxy-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 103228708 |
| Molecular Formula | C13H19ClFNO2 |
| Molecular Weight | 275.75 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-(3-chloro-4-fluorophenoxy)-3-methoxy-N-propan-2-ylpropan-1-amine |
| SMILES | COCC(CNC(C)C)Oc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H19ClFNO2/c1-9(2)16-7-11(8-17-3)18-10-4-5-13(15)12(14)6-10/h4-6,9,11,16H,7-8H2,1-3H3 |
| InChIKey | MKFCTEUWIVZZHB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |