C12H16Cl3NO2 — CID 55092907
N-(2-methoxyethyl)-2-(2,4,5-trichlorophenoxy)propan-1-amine (PubChem CID 55092907) has the molecular formula C12H16Cl3NO2 and a molecular weight of 312.62 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(2,4,5-trichlorophenoxy)propan-1-amine.
| Compound Name | N-(2-methoxyethyl)-2-(2,4,5-trichlorophenoxy)propan-1-amine |
|---|---|
| PubChem CID | 55092907 |
| Molecular Formula | C12H16Cl3NO2 |
| Molecular Weight | 312.62 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | N-(2-methoxyethyl)-2-(2,4,5-trichlorophenoxy)propan-1-amine |
| SMILES | COCCNCC(C)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl3NO2/c1-8(7-16-3-4-17-2)18-12-6-10(14)9(13)5-11(12)15/h5-6,8,16H,3-4,7H2,1-2H3 |
| InChIKey | JJJABPGREQJHSJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|