C12H16BrCl2NO2 — CID 107661071
2-(4-bromo-2,5-dichlorophenoxy)-N-ethyl-3-methoxypropan-1-amine (PubChem CID 107661071) has the molecular formula C12H16BrCl2NO2 and a molecular weight of 357.08 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dichlorophenoxy)-N-ethyl-3-methoxypropan-1-amine.
| Compound Name | 2-(4-bromo-2,5-dichlorophenoxy)-N-ethyl-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 107661071 |
| Molecular Formula | C12H16BrCl2NO2 |
| Molecular Weight | 357.08 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 2-(4-bromo-2,5-dichlorophenoxy)-N-ethyl-3-methoxypropan-1-amine |
| SMILES | CCNCC(COC)Oc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C12H16BrCl2NO2/c1-3-16-6-8(7-17-2)18-12-5-10(14)9(13)4-11(12)15/h4-5,8,16H,3,6-7H2,1-2H3 |
| InChIKey | NIEBXINEDSJXRG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.08 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|