C12H17ClFNO2 — CID 114264334
2-(2-chloro-5-fluorophenoxy)-N-ethyl-3-methoxypropan-1-amine (PubChem CID 114264334) has the molecular formula C12H17ClFNO2 and a molecular weight of 261.72 g/mol. Its IUPAC name is 2-(2-chloro-5-fluorophenoxy)-N-ethyl-3-methoxypropan-1-amine.
| Compound Name | 2-(2-chloro-5-fluorophenoxy)-N-ethyl-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 114264334 |
| Molecular Formula | C12H17ClFNO2 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-(2-chloro-5-fluorophenoxy)-N-ethyl-3-methoxypropan-1-amine |
| SMILES | CCNCC(COC)Oc1cc(F)ccc1Cl |
| InChI | InChI=1S/C12H17ClFNO2/c1-3-15-7-10(8-16-2)17-12-6-9(14)4-5-11(12)13/h4-6,10,15H,3,7-8H2,1-2H3 |
| InChIKey | YHEPYPUSXIAHER-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |