C14H20BrF2NO2 — CID 107101494
N-[2-(5-bromo-2,3-difluorophenoxy)-3-methoxypropyl]-2-methylpropan-1-amine (PubChem CID 107101494) has the molecular formula C14H20BrF2NO2 and a molecular weight of 352.22 g/mol. Its IUPAC name is N-[2-(5-bromo-2,3-difluorophenoxy)-3-methoxypropyl]-2-methylpropan-1-amine.
| Compound Name | N-[2-(5-bromo-2,3-difluorophenoxy)-3-methoxypropyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 107101494 |
| Molecular Formula | C14H20BrF2NO2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N-[2-(5-bromo-2,3-difluorophenoxy)-3-methoxypropyl]-2-methylpropan-1-amine |
| SMILES | COCC(CNCC(C)C)Oc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C14H20BrF2NO2/c1-9(2)6-18-7-11(8-19-3)20-13-5-10(15)4-12(16)14(13)17/h4-5,9,11,18H,6-8H2,1-3H3 |
| InChIKey | HKBAZQLQRNLYHY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|