C11H13BrF2N2O2 — CID 107101957
2-(5-bromo-2,3-difluorophenoxy)pentanehydrazide (PubChem CID 107101957) has the molecular formula C11H13BrF2N2O2 and a molecular weight of 323.14 g/mol. Its IUPAC name is 2-(5-bromo-2,3-difluorophenoxy)pentanehydrazide.
| Compound Name | 2-(5-bromo-2,3-difluorophenoxy)pentanehydrazide |
|---|---|
| PubChem CID | 107101957 |
| Molecular Formula | C11H13BrF2N2O2 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 2-(5-bromo-2,3-difluorophenoxy)pentanehydrazide |
| SMILES | CCCC(Oc1cc(Br)cc(F)c1F)C(=O)NN |
| InChI | InChI=1S/C11H13BrF2N2O2/c1-2-3-8(11(17)16-15)18-9-5-6(12)4-7(13)10(9)14/h4-5,8H,2-3,15H2,1H3,(H,16,17) |
| InChIKey | ADURSWORACQYRO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|