C12H16FN3O3 — CID 83047514
2-fluoro-6-(1-hydrazinyl-1-oxopentan-2-yl)oxybenzamide (PubChem CID 83047514) has the molecular formula C12H16FN3O3 and a molecular weight of 269.28 g/mol. Its IUPAC name is 2-fluoro-6-(1-hydrazinyl-1-oxopentan-2-yl)oxybenzamide.
| Compound Name | 2-fluoro-6-(1-hydrazinyl-1-oxopentan-2-yl)oxybenzamide |
|---|---|
| PubChem CID | 83047514 |
| Molecular Formula | C12H16FN3O3 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-fluoro-6-(1-hydrazinyl-1-oxopentan-2-yl)oxybenzamide |
| SMILES | CCCC(Oc1cccc(F)c1C(N)=O)C(=O)NN |
| InChI | InChI=1S/C12H16FN3O3/c1-2-4-9(12(18)16-15)19-8-6-3-5-7(13)10(8)11(14)17/h3,5-6,9H,2,4,15H2,1H3,(H2,14,17)(H,16,18) |
| InChIKey | OKFQCMVEGULGRE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|