C13H18FNO4 — CID 63630436
2-(2,2-diethoxyethoxy)-6-fluorobenzamide (PubChem CID 63630436) has the molecular formula C13H18FNO4 and a molecular weight of 271.29 g/mol. Its IUPAC name is 2-(2,2-diethoxyethoxy)-6-fluorobenzamide.
| Compound Name | 2-(2,2-diethoxyethoxy)-6-fluorobenzamide |
|---|---|
| PubChem CID | 63630436 |
| Molecular Formula | C13H18FNO4 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-(2,2-diethoxyethoxy)-6-fluorobenzamide |
| SMILES | CCOC(COc1cccc(F)c1C(N)=O)OCC |
| InChI | InChI=1S/C13H18FNO4/c1-3-17-11(18-4-2)8-19-10-7-5-6-9(14)12(10)13(15)16/h5-7,11H,3-4,8H2,1-2H3,(H2,15,16) |
| InChIKey | TYQZUMCHUHFTFC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|