C16H27NOS — CID 83044384
N-(2-methylpropyl)-2-(4-methylsulfanylphenoxy)pentan-1-amine (PubChem CID 83044384) has the molecular formula C16H27NOS and a molecular weight of 281.47 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-(4-methylsulfanylphenoxy)pentan-1-amine.
| Compound Name | N-(2-methylpropyl)-2-(4-methylsulfanylphenoxy)pentan-1-amine |
|---|---|
| PubChem CID | 83044384 |
| Molecular Formula | C16H27NOS |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N-(2-methylpropyl)-2-(4-methylsulfanylphenoxy)pentan-1-amine |
| SMILES | CCCC(CNCC(C)C)Oc1ccc(SC)cc1 |
| InChI | InChI=1S/C16H27NOS/c1-5-6-15(12-17-11-13(2)3)18-14-7-9-16(19-4)10-8-14/h7-10,13,15,17H,5-6,11-12H2,1-4H3 |
| InChIKey | LCZKGJVUDTVANT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |