C16H24Br2O2 — CID 102111957
1,4-dibromo-2,5-di(pentan-3-yloxy)benzene (PubChem CID 102111957) has the molecular formula C16H24Br2O2 and a molecular weight of 408.17 g/mol. Its IUPAC name is 1,4-dibromo-2,5-di(pentan-3-yloxy)benzene.
| Compound Name | 1,4-dibromo-2,5-di(pentan-3-yloxy)benzene |
|---|---|
| PubChem CID | 102111957 |
| Molecular Formula | C16H24Br2O2 |
| Molecular Weight | 408.17 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 1,4-dibromo-2,5-di(pentan-3-yloxy)benzene |
| SMILES | CCC(CC)Oc1cc(Br)c(OC(CC)CC)cc1Br |
| InChI | InChI=1S/C16H24Br2O2/c1-5-11(6-2)19-15-9-14(18)16(10-13(15)17)20-12(7-3)8-4/h9-12H,5-8H2,1-4H3 |
| InChIKey | OEWUWQNCMUHASY-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.17 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |