C12H16BrClO4S — CID 105057278
1-bromo-4-(1-chloro-2-methylsulfonylpropyl)-2,5-dimethoxybenzene (PubChem CID 105057278) has the molecular formula C12H16BrClO4S and a molecular weight of 371.68 g/mol. Its IUPAC name is 1-bromo-4-(1-chloro-2-methylsulfonylpropyl)-2,5-dimethoxybenzene.
| Compound Name | 1-bromo-4-(1-chloro-2-methylsulfonylpropyl)-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 105057278 |
| Molecular Formula | C12H16BrClO4S |
| Molecular Weight | 371.68 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | 1-bromo-4-(1-chloro-2-methylsulfonylpropyl)-2,5-dimethoxybenzene |
| SMILES | COc1cc(C(Cl)C(C)S(C)(=O)=O)c(OC)cc1Br |
| InChI | InChI=1S/C12H16BrClO4S/c1-7(19(4,15)16)12(14)8-5-11(18-3)9(13)6-10(8)17-2/h5-7,12H,1-4H3 |
| InChIKey | BSISAYOYQIHXOF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|