C13H20BrNO3S — CID 104518936
1-(5-bromo-2-methoxy-4-methylphenyl)-N-methyl-2-methylsulfonylpropan-1-amine (PubChem CID 104518936) has the molecular formula C13H20BrNO3S and a molecular weight of 350.28 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxy-4-methylphenyl)-N-methyl-2-methylsulfonylpropan-1-amine.
| Compound Name | 1-(5-bromo-2-methoxy-4-methylphenyl)-N-methyl-2-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 104518936 |
| Molecular Formula | C13H20BrNO3S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 1-(5-bromo-2-methoxy-4-methylphenyl)-N-methyl-2-methylsulfonylpropan-1-amine |
| SMILES | CNC(c1cc(Br)c(C)cc1OC)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C13H20BrNO3S/c1-8-6-12(18-4)10(7-11(8)14)13(15-3)9(2)19(5,16)17/h6-7,9,13,15H,1-5H3 |
| InChIKey | HWGPLLSKHPCNHU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |