C17H27ClO2 — CID 63435046
1-(1-chlorooctyl)-4,5-dimethoxy-2-methylbenzene (PubChem CID 63435046) has the molecular formula C17H27ClO2 and a molecular weight of 298.85 g/mol. Its IUPAC name is 1-(1-chlorooctyl)-4,5-dimethoxy-2-methylbenzene.
| Compound Name | 1-(1-chlorooctyl)-4,5-dimethoxy-2-methylbenzene |
|---|---|
| PubChem CID | 63435046 |
| Molecular Formula | C17H27ClO2 |
| Molecular Weight | 298.85 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-(1-chlorooctyl)-4,5-dimethoxy-2-methylbenzene |
| SMILES | CCCCCCCC(Cl)c1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C17H27ClO2/c1-5-6-7-8-9-10-15(18)14-12-17(20-4)16(19-3)11-13(14)2/h11-12,15H,5-10H2,1-4H3 |
| InChIKey | VIPWDYVKMPWDMG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.85 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|