C17H28O4 — CID 166530640
1-(4,5-dimethoxy-2-methylphenyl)octane-1,8-diol (PubChem CID 166530640) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-methylphenyl)octane-1,8-diol.
| Compound Name | 1-(4,5-dimethoxy-2-methylphenyl)octane-1,8-diol |
|---|---|
| PubChem CID | 166530640 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 1-(4,5-dimethoxy-2-methylphenyl)octane-1,8-diol |
| SMILES | COc1cc(C)c(C(O)CCCCCCCO)cc1OC |
| InChI | InChI=1S/C17H28O4/c1-13-11-16(20-2)17(21-3)12-14(13)15(19)9-7-5-4-6-8-10-18/h11-12,15,18-19H,4-10H2,1-3H3 |
| InChIKey | ZIWZYMVOLGEYMP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|