C18H29ClO2 — CID 63435087
1-(1-chloro-3,5,5-trimethylhexyl)-4,5-dimethoxy-2-methylbenzene (PubChem CID 63435087) has the molecular formula C18H29ClO2 and a molecular weight of 312.88 g/mol. Its IUPAC name is 1-(1-chloro-3,5,5-trimethylhexyl)-4,5-dimethoxy-2-methylbenzene.
| Compound Name | 1-(1-chloro-3,5,5-trimethylhexyl)-4,5-dimethoxy-2-methylbenzene |
|---|---|
| PubChem CID | 63435087 |
| Molecular Formula | C18H29ClO2 |
| Molecular Weight | 312.88 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1-(1-chloro-3,5,5-trimethylhexyl)-4,5-dimethoxy-2-methylbenzene |
| SMILES | COc1cc(C)c(C(Cl)CC(C)CC(C)(C)C)cc1OC |
| InChI | InChI=1S/C18H29ClO2/c1-12(11-18(3,4)5)8-15(19)14-10-17(21-7)16(20-6)9-13(14)2/h9-10,12,15H,8,11H2,1-7H3 |
| InChIKey | ZEFRINZUSWWUPU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.88 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|