C12H17ClO3 — CID 116863696
2-chloro-1-(4,5-dimethoxy-2-methylphenyl)propan-1-ol (PubChem CID 116863696) has the molecular formula C12H17ClO3 and a molecular weight of 244.72 g/mol. Its IUPAC name is 2-chloro-1-(4,5-dimethoxy-2-methylphenyl)propan-1-ol.
| Compound Name | 2-chloro-1-(4,5-dimethoxy-2-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 116863696 |
| Molecular Formula | C12H17ClO3 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-chloro-1-(4,5-dimethoxy-2-methylphenyl)propan-1-ol |
| SMILES | COc1cc(C)c(C(O)C(C)Cl)cc1OC |
| InChI | InChI=1S/C12H17ClO3/c1-7-5-10(15-3)11(16-4)6-9(7)12(14)8(2)13/h5-6,8,12,14H,1-4H3 |
| InChIKey | UCQHEDJXFWNOSA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|