C11H16O2 — CID 93182220
(1R)-1-(4-methoxy-2,5-dimethylphenyl)ethanol (PubChem CID 93182220) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1R)-1-(4-methoxy-2,5-dimethylphenyl)ethanol.
| Compound Name | (1R)-1-(4-methoxy-2,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 93182220 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1R)-1-(4-methoxy-2,5-dimethylphenyl)ethanol |
| SMILES | COc1cc(C)c([C@@H](C)O)cc1C |
| InChI | InChI=1S/C11H16O2/c1-7-6-11(13-4)8(2)5-10(7)9(3)12/h5-6,9,12H,1-4H3/t9-/m1/s1 |
| InChIKey | PVQULWFDRSTWTG-SECBINFHSA-N |
| XLogP | 2.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |