C11H16O3 — CID 84666953
1-(2,4-dimethoxy-5-methylphenyl)ethanol (PubChem CID 84666953) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(2,4-dimethoxy-5-methylphenyl)ethanol.
| Compound Name | 1-(2,4-dimethoxy-5-methylphenyl)ethanol |
|---|---|
| PubChem CID | 84666953 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1-(2,4-dimethoxy-5-methylphenyl)ethanol |
| SMILES | COc1cc(OC)c(C(C)O)cc1C |
| InChI | InChI=1S/C11H16O3/c1-7-5-9(8(2)12)11(14-4)6-10(7)13-3/h5-6,8,12H,1-4H3 |
| InChIKey | ZMZNZBRPEMSVQA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |