C17H28O3 — CID 61101083
1-(2,5-dimethoxyphenyl)-3,5,5-trimethylhexan-1-ol (PubChem CID 61101083) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3,5,5-trimethylhexan-1-ol.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3,5,5-trimethylhexan-1-ol |
|---|---|
| PubChem CID | 61101083 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3,5,5-trimethylhexan-1-ol |
| SMILES | COc1ccc(OC)c(C(O)CC(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C17H28O3/c1-12(11-17(2,3)4)9-15(18)14-10-13(19-5)7-8-16(14)20-6/h7-8,10,12,15,18H,9,11H2,1-6H3 |
| InChIKey | UTFIONMVRJOPOF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |