C16H26O5 — CID 106448693
1-(2,5-dimethoxyphenyl)-2-[2-(2-methylpropoxy)ethoxy]ethanol (PubChem CID 106448693) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[2-(2-methylpropoxy)ethoxy]ethanol.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[2-(2-methylpropoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 106448693 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[2-(2-methylpropoxy)ethoxy]ethanol |
| SMILES | COc1ccc(OC)c(C(O)COCCOCC(C)C)c1 |
| InChI | InChI=1S/C16H26O5/c1-12(2)10-20-7-8-21-11-15(17)14-9-13(18-3)5-6-16(14)19-4/h5-6,9,12,15,17H,7-8,10-11H2,1-4H3 |
| InChIKey | VTBLOJPDURVHAW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|