C16H24O4 — CID 66321390
2-(cyclopentylmethoxy)-1-(2,5-dimethoxyphenyl)ethanol (PubChem CID 66321390) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 2-(cyclopentylmethoxy)-1-(2,5-dimethoxyphenyl)ethanol.
| Compound Name | 2-(cyclopentylmethoxy)-1-(2,5-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 66321390 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-(cyclopentylmethoxy)-1-(2,5-dimethoxyphenyl)ethanol |
| SMILES | COc1ccc(OC)c(C(O)COCC2CCCC2)c1 |
| InChI | InChI=1S/C16H24O4/c1-18-13-7-8-16(19-2)14(9-13)15(17)11-20-10-12-5-3-4-6-12/h7-9,12,15,17H,3-6,10-11H2,1-2H3 |
| InChIKey | BFISKJFDUWQMHN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |