C17H26O2 — CID 62383414
2-(cyclohexylmethoxy)-1-(2,5-dimethylphenyl)ethanol (PubChem CID 62383414) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-(cyclohexylmethoxy)-1-(2,5-dimethylphenyl)ethanol.
| Compound Name | 2-(cyclohexylmethoxy)-1-(2,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 62383414 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-(cyclohexylmethoxy)-1-(2,5-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(C)c(C(O)COCC2CCCCC2)c1 |
| InChI | InChI=1S/C17H26O2/c1-13-8-9-14(2)16(10-13)17(18)12-19-11-15-6-4-3-5-7-15/h8-10,15,17-18H,3-7,11-12H2,1-2H3 |
| InChIKey | YFUJKOITTLPVCH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |