About 2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol
2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol (PubChem CID 114341933) has the molecular formula C18H28O2
and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol.
Molecular Properties
| Compound Name | 2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol |
| PubChem CID | 114341933 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(C)c(C(O)COC2CCC(C)(C)CC2)c1 |
| InChI | InChI=1S/C18H28O2/c1-13-5-6-14(2)16(11-13)17(19)12-20-15-7-9-18(3,4)10-8-15/h5-6,11,15,17,19H,7-10,12H2,1-4H3 |
| InChIKey | RPRIGTGEKVCSTE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol?
The IUPAC name of 2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol (CID 114341933) is 2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol.
What is the SMILES notation for 2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol?
The canonical SMILES for 2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol is Cc1ccc(C)c(C(O)COC2CCC(C)(C)CC2)c1.
What is the InChIKey of 2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol?
The InChIKey is RPRIGTGEKVCSTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-13-5-6-14(2)16(11-13)17(19)12-20-15-7-9-18(3,4)10-8-15/h5-6,11,15,17,19H,7-10,12H2,1-4H3.
What are the key properties of 2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol?
2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol has a molecular weight of 276.42 g/mol, XLogP of 4.32, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylcyclohexyl)oxy-1-(2,5-dimethylphenyl)ethanol is sourced from PubChem (CID 114341933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).