C17H24O4 — CID 114341931
1-(1,3-benzodioxol-5-yl)-2-(4,4-dimethylcyclohexyl)oxyethanol (PubChem CID 114341931) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(4,4-dimethylcyclohexyl)oxyethanol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(4,4-dimethylcyclohexyl)oxyethanol |
|---|---|
| PubChem CID | 114341931 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(4,4-dimethylcyclohexyl)oxyethanol |
| SMILES | CC1(C)CCC(OCC(O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C17H24O4/c1-17(2)7-5-13(6-8-17)19-10-14(18)12-3-4-15-16(9-12)21-11-20-15/h3-4,9,13-14,18H,5-8,10-11H2,1-2H3 |
| InChIKey | RYLAXWALELSYCK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |